C11H16FNOS — CID 79574558
1-(4-fluorophenyl)sulfanyl-3-methoxy-N-methylpropan-2-amine (PubChem CID 79574558) has the molecular formula C11H16FNOS and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfanyl-3-methoxy-N-methylpropan-2-amine.
| Compound Name | 1-(4-fluorophenyl)sulfanyl-3-methoxy-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 79574558 |
| Molecular Formula | C11H16FNOS |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(4-fluorophenyl)sulfanyl-3-methoxy-N-methylpropan-2-amine |
| SMILES | CNC(COC)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C11H16FNOS/c1-13-10(7-14-2)8-15-11-5-3-9(12)4-6-11/h3-6,10,13H,7-8H2,1-2H3 |
| InChIKey | UKVPGGQNTHHHNG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |