C15H28N2OS — CID 79577878
2-[2-(3-hydroxy-2-methylpropyl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile (PubChem CID 79577878) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-[2-(3-hydroxy-2-methylpropyl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile.
| Compound Name | 2-[2-(3-hydroxy-2-methylpropyl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79577878 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[2-(3-hydroxy-2-methylpropyl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCCC1CCSCC(C)CO |
| InChI | InChI=1S/C15H28N2OS/c1-3-8-17-15(12-16)7-4-5-14(15)6-9-19-11-13(2)10-18/h13-14,17-18H,3-11H2,1-2H3 |
| InChIKey | SXSBPHOMXYMNNR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|