C13H22N6S — CID 79578195
2-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile (PubChem CID 79578195) has the molecular formula C13H22N6S and a molecular weight of 294.43 g/mol. Its IUPAC name is 2-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile.
| Compound Name | 2-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79578195 |
| Molecular Formula | C13H22N6S |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-1-(propylamino)cyclopentane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCCC1CCSc1nnnn1C |
| InChI | InChI=1S/C13H22N6S/c1-3-8-15-13(10-14)7-4-5-11(13)6-9-20-12-16-17-18-19(12)2/h11,15H,3-9H2,1-2H3 |
| InChIKey | UHODYHWETRAXIE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |