C9H15NO3S2 — CID 79578342
2-hydroxy-N-(1-thiophen-2-ylpropan-2-yl)ethanesulfonamide (PubChem CID 79578342) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-hydroxy-N-(1-thiophen-2-ylpropan-2-yl)ethanesulfonamide.
| Compound Name | 2-hydroxy-N-(1-thiophen-2-ylpropan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 79578342 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-hydroxy-N-(1-thiophen-2-ylpropan-2-yl)ethanesulfonamide |
| SMILES | CC(Cc1cccs1)NS(=O)(=O)CCO |
| InChI | InChI=1S/C9H15NO3S2/c1-8(7-9-3-2-5-14-9)10-15(12,13)6-4-11/h2-3,5,8,10-11H,4,6-7H2,1H3 |
| InChIKey | JJEUQVUBERIKTF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |