About 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid
2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid (PubChem CID 79580426) has the molecular formula C9H17NO6S2
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid.
Molecular Properties
| Compound Name | 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid |
| PubChem CID | 79580426 |
| Molecular Formula | C9H17NO6S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid |
| SMILES | CC1CN(C(CCS(C)(=O)=O)C(=O)O)S(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO6S2/c1-7-5-10(18(15,16)6-7)8(9(11)12)3-4-17(2,13)14/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | FFQWEQQFARSTPE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid?
The IUPAC name of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid (CID 79580426) is 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid.
What is the SMILES notation for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid?
The canonical SMILES for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid is CC1CN(C(CCS(C)(=O)=O)C(=O)O)S(=O)(=O)C1.
What is the InChIKey of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid?
The InChIKey is FFQWEQQFARSTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO6S2/c1-7-5-10(18(15,16)6-7)8(9(11)12)3-4-17(2,13)14/h7-8H,3-6H2,1-2H3,(H,11,12).
What are the key properties of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid?
2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid has a molecular weight of 299.37 g/mol, XLogP of -0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylsulfonylbutanoic acid is sourced from PubChem (CID 79580426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).