C13H25NO3 — CID 79580990
[1-(methylamino)-2-[2-(oxolan-3-yloxy)ethyl]cyclopentyl]methanol (PubChem CID 79580990) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is [1-(methylamino)-2-[2-(oxolan-3-yloxy)ethyl]cyclopentyl]methanol.
| Compound Name | [1-(methylamino)-2-[2-(oxolan-3-yloxy)ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79580990 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | [1-(methylamino)-2-[2-(oxolan-3-yloxy)ethyl]cyclopentyl]methanol |
| SMILES | CNC1(CO)CCCC1CCOC1CCOC1 |
| InChI | InChI=1S/C13H25NO3/c1-14-13(10-15)6-2-3-11(13)4-8-17-12-5-7-16-9-12/h11-12,14-15H,2-10H2,1H3 |
| InChIKey | HQABQPPJNKYXND-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |