C15H27N3OS — CID 79581049
[2-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-(propylamino)cyclopentyl]methanol (PubChem CID 79581049) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is [2-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-(propylamino)cyclopentyl]methanol.
| Compound Name | [2-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-(propylamino)cyclopentyl]methanol |
|---|---|
| PubChem CID | 79581049 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [2-[2-(1-methylimidazol-2-yl)sulfanylethyl]-1-(propylamino)cyclopentyl]methanol |
| SMILES | CCCNC1(CO)CCCC1CCSc1nccn1C |
| InChI | InChI=1S/C15H27N3OS/c1-3-8-17-15(12-19)7-4-5-13(15)6-11-20-14-16-9-10-18(14)2/h9-10,13,17,19H,3-8,11-12H2,1-2H3 |
| InChIKey | GRPGRQCTSWNUGP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |