C15H22N4S — CID 79576943
1-(cyclopropylamino)-2-[2-(1-methylimidazol-2-yl)sulfanylethyl]cyclopentane-1-carbonitrile (PubChem CID 79576943) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 1-(cyclopropylamino)-2-[2-(1-methylimidazol-2-yl)sulfanylethyl]cyclopentane-1-carbonitrile.
| Compound Name | 1-(cyclopropylamino)-2-[2-(1-methylimidazol-2-yl)sulfanylethyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79576943 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(cyclopropylamino)-2-[2-(1-methylimidazol-2-yl)sulfanylethyl]cyclopentane-1-carbonitrile |
| SMILES | Cn1ccnc1SCCC1CCCC1(C#N)NC1CC1 |
| InChI | InChI=1S/C15H22N4S/c1-19-9-8-17-14(19)20-10-6-12-3-2-7-15(12,11-16)18-13-4-5-13/h8-9,12-13,18H,2-7,10H2,1H3 |
| InChIKey | DFCDJSNQPFMLFV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |