C11H20ClF3N2O2S — CID 79585238
3-chloro-2-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propane-1-sulfonamide (PubChem CID 79585238) has the molecular formula C11H20ClF3N2O2S and a molecular weight of 336.81 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79585238 |
| Molecular Formula | C11H20ClF3N2O2S |
| Molecular Weight | 336.81 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-chloro-2-methyl-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C11H20ClF3N2O2S/c1-9(4-12)7-20(18,19)16-5-10-2-3-17(6-10)8-11(13,14)15/h9-10,16H,2-8H2,1H3 |
| InChIKey | GGCUZMADHNFZAK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.81 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|