C16H22BrNO2S — CID 79587982
2-[2-(4-bromophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxylic acid (PubChem CID 79587982) has the molecular formula C16H22BrNO2S and a molecular weight of 372.33 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 2-[2-(4-bromophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 79587982 |
| Molecular Formula | C16H22BrNO2S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxylic acid |
| SMILES | CCNC1(C(=O)O)CCCC1CCSc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrNO2S/c1-2-18-16(15(19)20)10-3-4-12(16)9-11-21-14-7-5-13(17)6-8-14/h5-8,12,18H,2-4,9-11H2,1H3,(H,19,20) |
| InChIKey | VYFVWADNAGAFDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |