C16H23ClN2OS — CID 79588248
2-[2-(4-chlorophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxamide (PubChem CID 79588248) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79588248 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfanylethyl]-1-(ethylamino)cyclopentane-1-carboxamide |
| SMILES | CCNC1(C(N)=O)CCCC1CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H23ClN2OS/c1-2-19-16(15(18)20)10-3-4-12(16)9-11-21-14-7-5-13(17)6-8-14/h5-8,12,19H,2-4,9-11H2,1H3,(H2,18,20) |
| InChIKey | RMOHXQAEYATARB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |