C15H23ClN2 — CID 79590236
3-(5-chloro-2-methylpent-2-enyl)-1-cyclohexylpyrazole (PubChem CID 79590236) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 3-(5-chloro-2-methylpent-2-enyl)-1-cyclohexylpyrazole.
| Compound Name | 3-(5-chloro-2-methylpent-2-enyl)-1-cyclohexylpyrazole |
|---|---|
| PubChem CID | 79590236 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(5-chloro-2-methylpent-2-enyl)-1-cyclohexylpyrazole |
| SMILES | CC(=CCCCl)Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H23ClN2/c1-13(6-5-10-16)12-14-9-11-18(17-14)15-7-3-2-4-8-15/h6,9,11,15H,2-5,7-8,10,12H2,1H3 |
| InChIKey | RJQULVSAHHMZCO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|