C17H29N3 — CID 79599253
5-(1-cyclopentylpyrazol-3-yl)-4-methyl-N-propylpent-3-en-1-amine (PubChem CID 79599253) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-(1-cyclopentylpyrazol-3-yl)-4-methyl-N-propylpent-3-en-1-amine.
| Compound Name | 5-(1-cyclopentylpyrazol-3-yl)-4-methyl-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79599253 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 5-(1-cyclopentylpyrazol-3-yl)-4-methyl-N-propylpent-3-en-1-amine |
| SMILES | CCCNCCC=C(C)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C17H29N3/c1-3-11-18-12-6-7-15(2)14-16-10-13-20(19-16)17-8-4-5-9-17/h7,10,13,17-18H,3-6,8-9,11-12,14H2,1-2H3 |
| InChIKey | AXWRQUILJPXRBD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|