C10H14BrNS — CID 79592689
5-(3-bromothiophen-2-yl)-4-methylpent-3-en-1-amine (PubChem CID 79592689) has the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. Its IUPAC name is 5-(3-bromothiophen-2-yl)-4-methylpent-3-en-1-amine.
| Compound Name | 5-(3-bromothiophen-2-yl)-4-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 79592689 |
| Molecular Formula | C10H14BrNS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 5-(3-bromothiophen-2-yl)-4-methylpent-3-en-1-amine |
| SMILES | CC(=CCCN)Cc1sccc1Br |
| InChI | InChI=1S/C10H14BrNS/c1-8(3-2-5-12)7-10-9(11)4-6-13-10/h3-4,6H,2,5,7,12H2,1H3 |
| InChIKey | QFHDIYVYQUOOCT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|