C12H18N2O3S2 — CID 79594551
4-(2-propan-2-yloxyethylsulfonylamino)benzenecarbothioamide (PubChem CID 79594551) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-(2-propan-2-yloxyethylsulfonylamino)benzenecarbothioamide.
| Compound Name | 4-(2-propan-2-yloxyethylsulfonylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 79594551 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(2-propan-2-yloxyethylsulfonylamino)benzenecarbothioamide |
| SMILES | CC(C)OCCS(=O)(=O)Nc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-9(2)17-7-8-19(15,16)14-11-5-3-10(4-6-11)12(13)18/h3-6,9,14H,7-8H2,1-2H3,(H2,13,18) |
| InChIKey | ASSOICHZMAQBHK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|