C9H16N4O3S2 — CID 79593868
5-(2-propan-2-yloxyethylsulfonylamino)-1H-pyrazole-4-carbothioamide (PubChem CID 79593868) has the molecular formula C9H16N4O3S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 5-(2-propan-2-yloxyethylsulfonylamino)-1H-pyrazole-4-carbothioamide.
| Compound Name | 5-(2-propan-2-yloxyethylsulfonylamino)-1H-pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 79593868 |
| Molecular Formula | C9H16N4O3S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 5-(2-propan-2-yloxyethylsulfonylamino)-1H-pyrazole-4-carbothioamide |
| SMILES | CC(C)OCCS(=O)(=O)Nc1[nH]ncc1C(N)=S |
| InChI | InChI=1S/C9H16N4O3S2/c1-6(2)16-3-4-18(14,15)13-9-7(8(10)17)5-11-12-9/h5-6H,3-4H2,1-2H3,(H2,10,17)(H2,11,12,13) |
| InChIKey | UWNYORLWTFGNLZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|