C12H10N4O — CID 79599904
(3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanol (PubChem CID 79599904) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanol.
| Compound Name | (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanol |
|---|---|
| PubChem CID | 79599904 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanol |
| SMILES | OCc1nc(-c2ccc3ccccc3n2)n[nH]1 |
| InChI | InChI=1S/C12H10N4O/c17-7-11-14-12(16-15-11)10-6-5-8-3-1-2-4-9(8)13-10/h1-6,17H,7H2,(H,14,15,16) |
| InChIKey | YVBUWLJORBUMFO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |