C12H11N5 — CID 55163117
(3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanamine (PubChem CID 55163117) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanamine.
| Compound Name | (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanamine |
|---|---|
| PubChem CID | 55163117 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (3-quinolin-2-yl-1H-1,2,4-triazol-5-yl)methanamine |
| SMILES | NCc1nc(-c2ccc3ccccc3n2)n[nH]1 |
| InChI | InChI=1S/C12H11N5/c13-7-11-15-12(17-16-11)10-6-5-8-3-1-2-4-9(8)14-10/h1-6H,7,13H2,(H,15,16,17) |
| InChIKey | MEUWLDCIGWLTKB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |