C14H14N4 — CID 62952070
2-(3-naphthalen-1-yl-1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 62952070) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(3-naphthalen-1-yl-1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | 2-(3-naphthalen-1-yl-1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 62952070 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-(3-naphthalen-1-yl-1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | NCCc1nc(-c2cccc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C14H14N4/c15-9-8-13-16-14(18-17-13)12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9,15H2,(H,16,17,18) |
| InChIKey | XJCTZYGGNPQHDH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |