C11H4Br2F2OS — CID 79602224
(3,4-dibromothiophen-2-yl)-(3,5-difluorophenyl)methanone (PubChem CID 79602224) has the molecular formula C11H4Br2F2OS and a molecular weight of 382.02 g/mol. Its IUPAC name is (3,4-dibromothiophen-2-yl)-(3,5-difluorophenyl)methanone.
| Compound Name | (3,4-dibromothiophen-2-yl)-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 79602224 |
| Molecular Formula | C11H4Br2F2OS |
| Molecular Weight | 382.02 g/mol |
| Exact Mass | 379.83 |
| IUPAC Name | (3,4-dibromothiophen-2-yl)-(3,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1scc(Br)c1Br |
| InChI | InChI=1S/C11H4Br2F2OS/c12-8-4-17-11(9(8)13)10(16)5-1-6(14)3-7(15)2-5/h1-4H |
| InChIKey | KUXXWKYGAFWAKT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.02 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |