C14H22N2OS — CID 79603969
2-[1-(methylamino)ethyl]-5-(1,4-thiazepan-4-yl)phenol (PubChem CID 79603969) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[1-(methylamino)ethyl]-5-(1,4-thiazepan-4-yl)phenol.
| Compound Name | 2-[1-(methylamino)ethyl]-5-(1,4-thiazepan-4-yl)phenol |
|---|---|
| PubChem CID | 79603969 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[1-(methylamino)ethyl]-5-(1,4-thiazepan-4-yl)phenol |
| SMILES | CNC(C)c1ccc(N2CCCSCC2)cc1O |
| InChI | InChI=1S/C14H22N2OS/c1-11(15-2)13-5-4-12(10-14(13)17)16-6-3-8-18-9-7-16/h4-5,10-11,15,17H,3,6-9H2,1-2H3 |
| InChIKey | XARZHAIKOGRJQJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|