C23H28N2O5 — CID 7960461
2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-4-propoxybenzaldehyde (PubChem CID 7960461) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-4-propoxybenzaldehyde.
| Compound Name | 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-4-propoxybenzaldehyde |
|---|---|
| PubChem CID | 7960461 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]-4-propoxybenzaldehyde |
| SMILES | CCCOc1ccc(C=O)c(OCC(=O)N2CCN(c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-3-14-29-21-7-4-18(16-26)22(15-21)30-17-23(27)25-12-10-24(11-13-25)19-5-8-20(28-2)9-6-19/h4-9,15-16H,3,10-14,17H2,1-2H3 |
| InChIKey | DSGGTMPFHKKORQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|