C13H27NO — CID 79607917
N-(2-methoxyethyl)-4,6-dimethyloct-3-en-1-amine (PubChem CID 79607917) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4,6-dimethyloct-3-en-1-amine.
| Compound Name | N-(2-methoxyethyl)-4,6-dimethyloct-3-en-1-amine |
|---|---|
| PubChem CID | 79607917 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-(2-methoxyethyl)-4,6-dimethyloct-3-en-1-amine |
| SMILES | CCC(C)CC(C)=CCCNCCOC |
| InChI | InChI=1S/C13H27NO/c1-5-12(2)11-13(3)7-6-8-14-9-10-15-4/h7,12,14H,5-6,8-11H2,1-4H3 |
| InChIKey | FHVBQIMWIQVAJY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|