C15H21N3O2S — CID 79611433
4-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylamino]benzenesulfonamide (PubChem CID 79611433) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylamino]benzenesulfonamide.
| Compound Name | 4-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 79611433 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[(1-ethyl-2,5-dimethylpyrrol-3-yl)methylamino]benzenesulfonamide |
| SMILES | CCn1c(C)cc(CNc2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C15H21N3O2S/c1-4-18-11(2)9-13(12(18)3)10-17-14-5-7-15(8-6-14)21(16,19)20/h5-9,17H,4,10H2,1-3H3,(H2,16,19,20) |
| InChIKey | MGFUXMMPCMCTGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |