C11H22N2 — CID 796159
1-[(1R,2S)-2-methylcyclohexyl]piperazine (PubChem CID 796159) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclohexyl]piperazine.
| Compound Name | 1-[(1R,2S)-2-methylcyclohexyl]piperazine |
|---|---|
| PubChem CID | 796159 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclohexyl]piperazine |
| SMILES | C[C@H]1CCCC[C@H]1N1CCNCC1 |
| InChI | InChI=1S/C11H22N2/c1-10-4-2-3-5-11(10)13-8-6-12-7-9-13/h10-12H,2-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | ZYJADGWLXSPEIR-WDEREUQCSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |