C10H19FN2 — CID 126848005
1-[(1R,2R)-2-fluorocyclohexyl]piperazine (PubChem CID 126848005) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclohexyl]piperazine.
| Compound Name | 1-[(1R,2R)-2-fluorocyclohexyl]piperazine |
|---|---|
| PubChem CID | 126848005 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclohexyl]piperazine |
| SMILES | F[C@@H]1CCCC[C@H]1N1CCNCC1 |
| InChI | InChI=1S/C10H19FN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| InChIKey | WLUAREPMTQSKGO-NXEZZACHSA-N |
| XLogP | 1.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |