C14H27N3 — CID 54977827
1-(1,5-diazocan-1-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 54977827) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(1,5-diazocan-1-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 1-(1,5-diazocan-1-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 54977827 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-(1,5-diazocan-1-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C1CCN2CCC(N3CCCNCCC3)C2C1 |
| InChI | InChI=1S/C14H27N3/c1-2-9-17-12-6-14(13(17)5-1)16-10-3-7-15-8-4-11-16/h13-15H,1-12H2 |
| InChIKey | WLWRQAIZSPOYKD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |