C11H19N3O — CID 79616612
N,6-diethyl-2-(1-methoxyethyl)pyrimidin-4-amine (PubChem CID 79616612) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N,6-diethyl-2-(1-methoxyethyl)pyrimidin-4-amine.
| Compound Name | N,6-diethyl-2-(1-methoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79616612 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N,6-diethyl-2-(1-methoxyethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(CC)nc(C(C)OC)n1 |
| InChI | InChI=1S/C11H19N3O/c1-5-9-7-10(12-6-2)14-11(13-9)8(3)15-4/h7-8H,5-6H2,1-4H3,(H,12,13,14) |
| InChIKey | UKJJIXPEEIHOOK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |