C15H27NO4S — CID 79620250
3-methyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 79620250) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is 3-methyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79620250 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-methyl-1-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(CC2CCCN(S(C)(=O)=O)C2)(C(=O)O)C1 |
| InChI | InChI=1S/C15H27NO4S/c1-12-5-3-7-15(9-12,14(17)18)10-13-6-4-8-16(11-13)21(2,19)20/h12-13H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | RTTWCFWHMTZSKU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |