C9H18F3N3O — CID 79626181
3-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanehydrazide (PubChem CID 79626181) has the molecular formula C9H18F3N3O and a molecular weight of 241.26 g/mol. Its IUPAC name is 3-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanehydrazide.
| Compound Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79626181 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[ethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanehydrazide |
| SMILES | CCN(CC(F)(F)F)CC(C)(C)C(=O)NN |
| InChI | InChI=1S/C9H18F3N3O/c1-4-15(6-9(10,11)12)5-8(2,3)7(16)14-13/h4-6,13H2,1-3H3,(H,14,16) |
| InChIKey | LAONHPJRRRHHRC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|