C12H26N4O2 — CID 79630687
N,N-diethyl-2-[(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)-methylamino]acetamide (PubChem CID 79630687) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is N,N-diethyl-2-[(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)-methylamino]acetamide |
|---|---|
| PubChem CID | 79630687 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N,N-diethyl-2-[(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)-methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CN(C)CC(C)(C)C(=O)NN |
| InChI | InChI=1S/C12H26N4O2/c1-6-16(7-2)10(17)8-15(5)9-12(3,4)11(18)14-13/h6-9,13H2,1-5H3,(H,14,18) |
| InChIKey | QDFYTFIVURITIF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|