C18H35N3 — CID 79628235
3-[butan-2-yl(butyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carbonitrile (PubChem CID 79628235) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 3-[butan-2-yl(butyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carbonitrile.
| Compound Name | 3-[butan-2-yl(butyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79628235 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 3-[butan-2-yl(butyl)amino]-1-(propan-2-ylamino)cyclohexane-1-carbonitrile |
| SMILES | CCCCN(C(C)CC)C1CCCC(C#N)(NC(C)C)C1 |
| InChI | InChI=1S/C18H35N3/c1-6-8-12-21(16(5)7-2)17-10-9-11-18(13-17,14-19)20-15(3)4/h15-17,20H,6-13H2,1-5H3 |
| InChIKey | PSVDICAIAQYJPA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |