C15H29N3 — CID 79625630
3-[butyl(methyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile (PubChem CID 79625630) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile.
| Compound Name | 3-[butyl(methyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79625630 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 3-[butyl(methyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile |
| SMILES | CCCCN(C)C1CCCC(C#N)(NCCC)C1 |
| InChI | InChI=1S/C15H29N3/c1-4-6-11-18(3)14-8-7-9-15(12-14,13-16)17-10-5-2/h14,17H,4-12H2,1-3H3 |
| InChIKey | ZSTUFXZNQVGKPV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |