C14H27N3O2S — CID 79858170
3-[methyl(2-methylsulfonylethyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile (PubChem CID 79858170) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 3-[methyl(2-methylsulfonylethyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile.
| Compound Name | 3-[methyl(2-methylsulfonylethyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79858170 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-[methyl(2-methylsulfonylethyl)amino]-1-(propylamino)cyclohexane-1-carbonitrile |
| SMILES | CCCNC1(C#N)CCCC(N(C)CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H27N3O2S/c1-4-8-16-14(12-15)7-5-6-13(11-14)17(2)9-10-20(3,18)19/h13,16H,4-11H2,1-3H3 |
| InChIKey | FYBYRTHPYHUGRN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |