C15H29N3O — CID 81062280
1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carbonitrile (PubChem CID 81062280) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carbonitrile.
| Compound Name | 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 81062280 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCCC(N(C)CCOC(C)C)C1 |
| InChI | InChI=1S/C15H29N3O/c1-5-17-15(12-16)8-6-7-14(11-15)18(4)9-10-19-13(2)3/h13-14,17H,5-11H2,1-4H3 |
| InChIKey | QPTGHJRWLARFCR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |