C15H30N2O3 — CID 81074828
1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 81074828) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81074828 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-(ethylamino)-3-[methyl(2-propan-2-yloxyethyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | CCNC1(C(=O)O)CCCC(N(C)CCOC(C)C)C1 |
| InChI | InChI=1S/C15H30N2O3/c1-5-16-15(14(18)19)8-6-7-13(11-15)17(4)9-10-20-12(2)3/h12-13,16H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | CYEONFFJPQUKLY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |