C14H23F3N2O2 — CID 79633959
methyl 1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexane-1-carboxylate (PubChem CID 79633959) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is methyl 1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 79633959 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methyl 1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCC(N2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-21-12(20)13(18)6-2-3-11(9-13)19-7-4-10(5-8-19)14(15,16)17/h10-11H,2-9,18H2,1H3 |
| InChIKey | IPISGOAFRIKOGT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |