C13H23F3N2O — CID 79641042
[1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexyl]methanol (PubChem CID 79641042) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is [1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexyl]methanol.
| Compound Name | [1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 79641042 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [1-amino-3-[4-(trifluoromethyl)piperidin-1-yl]cyclohexyl]methanol |
| SMILES | NC1(CO)CCCC(N2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C13H23F3N2O/c14-13(15,16)10-3-6-18(7-4-10)11-2-1-5-12(17,8-11)9-19/h10-11,19H,1-9,17H2 |
| InChIKey | XTNIOOQGQBXWKK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |