C9H18N2OS — CID 79634172
1-(methylamino)-3-methylsulfanylcyclohexane-1-carboxamide (PubChem CID 79634172) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 1-(methylamino)-3-methylsulfanylcyclohexane-1-carboxamide.
| Compound Name | 1-(methylamino)-3-methylsulfanylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79634172 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(methylamino)-3-methylsulfanylcyclohexane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCCC(SC)C1 |
| InChI | InChI=1S/C9H18N2OS/c1-11-9(8(10)12)5-3-4-7(6-9)13-2/h7,11H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | JNCHNNIMCVIWFX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |