C16H20FNO3 — CID 79635234
1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclohexane-1-carboxylic acid (PubChem CID 79635234) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79635234 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(NC2CC2)CCCC(Oc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H20FNO3/c17-11-3-1-4-13(9-11)21-14-5-2-8-16(10-14,15(19)20)18-12-6-7-12/h1,3-4,9,12,14,18H,2,5-8,10H2,(H,19,20) |
| InChIKey | NGLWBHHOOUYQMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |