C16H20FNO3 — CID 79647932
methyl 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclopentane-1-carboxylate (PubChem CID 79647932) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79647932 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 1-(cyclopropylamino)-3-(3-fluorophenoxy)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC2CC2)CCC(Oc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H20FNO3/c1-20-15(19)16(18-12-5-6-12)8-7-14(10-16)21-13-4-2-3-11(17)9-13/h2-4,9,12,14,18H,5-8,10H2,1H3 |
| InChIKey | MIEDBZUFCXHIQN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |