C12H17N3O2S — CID 79635477
1-amino-3-(5-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carboxylic acid (PubChem CID 79635477) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-amino-3-(5-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 1-amino-3-(5-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79635477 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-amino-3-(5-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carboxylic acid |
| SMILES | Cc1cnc(SC2CCCC(N)(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C12H17N3O2S/c1-8-6-14-11(15-7-8)18-9-3-2-4-12(13,5-9)10(16)17/h6-7,9H,2-5,13H2,1H3,(H,16,17) |
| InChIKey | MCBWLZATLZYOLK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |