C13H23N5O2S — CID 79635597
ethyl 1-(ethylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carboxylate (PubChem CID 79635597) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is ethyl 1-(ethylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carboxylate.
| Compound Name | ethyl 1-(ethylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 79635597 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | ethyl 1-(ethylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carboxylate |
| SMILES | CCNC1(C(=O)OCC)CCCC(Sc2nnnn2C)C1 |
| InChI | InChI=1S/C13H23N5O2S/c1-4-14-13(11(19)20-5-2)8-6-7-10(9-13)21-12-15-16-17-18(12)3/h10,14H,4-9H2,1-3H3 |
| InChIKey | OIEGPMIUJBHQNQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |