C12H21N5O2S — CID 79654534
methyl 3-(1-methyltetrazol-5-yl)sulfanyl-1-(propan-2-ylamino)cyclopentane-1-carboxylate (PubChem CID 79654534) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 3-(1-methyltetrazol-5-yl)sulfanyl-1-(propan-2-ylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl 3-(1-methyltetrazol-5-yl)sulfanyl-1-(propan-2-ylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79654534 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | methyl 3-(1-methyltetrazol-5-yl)sulfanyl-1-(propan-2-ylamino)cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(C)C)CCC(Sc2nnnn2C)C1 |
| InChI | InChI=1S/C12H21N5O2S/c1-8(2)13-12(10(18)19-4)6-5-9(7-12)20-11-14-15-16-17(11)3/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | SFCZOWXYDALNPK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |