C10H16N6S — CID 79637008
1-(methylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carbonitrile (PubChem CID 79637008) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-(methylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carbonitrile.
| Compound Name | 1-(methylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79637008 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-(methylamino)-3-(1-methyltetrazol-5-yl)sulfanylcyclohexane-1-carbonitrile |
| SMILES | CNC1(C#N)CCCC(Sc2nnnn2C)C1 |
| InChI | InChI=1S/C10H16N6S/c1-12-10(7-11)5-3-4-8(6-10)17-9-13-14-15-16(9)2/h8,12H,3-6H2,1-2H3 |
| InChIKey | GWIKFXUJLWICJP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |