C14H21N5S — CID 79650139
1-(methylamino)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)cyclopentane-1-carbonitrile (PubChem CID 79650139) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(methylamino)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)cyclopentane-1-carbonitrile.
| Compound Name | 1-(methylamino)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79650139 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-(methylamino)-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)cyclopentane-1-carbonitrile |
| SMILES | CNC1(C#N)CCC(Sc2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C14H21N5S/c1-16-14(10-15)7-6-11(9-14)20-13-18-17-12-5-3-2-4-8-19(12)13/h11,16H,2-9H2,1H3 |
| InChIKey | ALDOJTYAZBLRKR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |