C13H18N4S — CID 79636794
1-(methylamino)-3-(4-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carbonitrile (PubChem CID 79636794) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(methylamino)-3-(4-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carbonitrile.
| Compound Name | 1-(methylamino)-3-(4-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79636794 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(methylamino)-3-(4-methylpyrimidin-2-yl)sulfanylcyclohexane-1-carbonitrile |
| SMILES | CNC1(C#N)CCCC(Sc2nccc(C)n2)C1 |
| InChI | InChI=1S/C13H18N4S/c1-10-5-7-16-12(17-10)18-11-4-3-6-13(8-11,9-14)15-2/h5,7,11,15H,3-4,6,8H2,1-2H3 |
| InChIKey | OFWHUNNVOXNGLT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |