C13H21N3O2S — CID 138019551
4-methyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrimidin-2-amine (PubChem CID 138019551) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-methyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-methyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138019551 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-methyl-N-[(4-methylsulfonylcyclohexyl)methyl]pyrimidin-2-amine |
| SMILES | Cc1ccnc(NCC2CCC(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10-7-8-14-13(16-10)15-9-11-3-5-12(6-4-11)19(2,17)18/h7-8,11-12H,3-6,9H2,1-2H3,(H,14,15,16) |
| InChIKey | NTFDFWXKOBOQEJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |