C15H30N4O — CID 79636895
1-(methylamino)-3-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexane-1-carboxamide (PubChem CID 79636895) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(methylamino)-3-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexane-1-carboxamide.
| Compound Name | 1-(methylamino)-3-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79636895 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 1-(methylamino)-3-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCCC(N(C)C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C15H30N4O/c1-17-15(14(16)20)8-4-5-13(11-15)19(3)12-6-9-18(2)10-7-12/h12-13,17H,4-11H2,1-3H3,(H2,16,20) |
| InChIKey | VWLJMINFHRNVDB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |