C15H30N2O2 — CID 79637541
1-amino-3-octan-2-yloxycyclohexane-1-carboxamide (PubChem CID 79637541) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-amino-3-octan-2-yloxycyclohexane-1-carboxamide.
| Compound Name | 1-amino-3-octan-2-yloxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79637541 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-amino-3-octan-2-yloxycyclohexane-1-carboxamide |
| SMILES | CCCCCCC(C)OC1CCCC(N)(C(N)=O)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-3-4-5-6-8-12(2)19-13-9-7-10-15(17,11-13)14(16)18/h12-13H,3-11,17H2,1-2H3,(H2,16,18) |
| InChIKey | NCMNYZGKCONWJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|